About 2-ethoxy-N-iodoacetamide
2-ethoxy-N-iodoacetamide (PubChem CID 153012942) has the molecular formula C4H8INO2
and a molecular weight of 229.02 g/mol. Its IUPAC name is 2-ethoxy-N-iodoacetamide.
Molecular Properties
| Compound Name | 2-ethoxy-N-iodoacetamide |
| PubChem CID | 153012942 |
| Molecular Formula | C4H8INO2 |
| Molecular Weight | 229.02 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | 2-ethoxy-N-iodoacetamide |
| SMILES | CCOCC(=O)NI |
| InChI | InChI=1S/C4H8INO2/c1-2-8-3-4(7)6-5/h2-3H2,1H3,(H,6,7) |
| InChIKey | VAKDSAJDQMESDB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.02 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N-iodoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-iodoacetamide?
The IUPAC name of 2-ethoxy-N-iodoacetamide (CID 153012942) is 2-ethoxy-N-iodoacetamide.
What is the SMILES notation for 2-ethoxy-N-iodoacetamide?
The canonical SMILES for 2-ethoxy-N-iodoacetamide is CCOCC(=O)NI.
What is the InChIKey of 2-ethoxy-N-iodoacetamide?
The InChIKey is VAKDSAJDQMESDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8INO2/c1-2-8-3-4(7)6-5/h2-3H2,1H3,(H,6,7).
What are the key properties of 2-ethoxy-N-iodoacetamide?
2-ethoxy-N-iodoacetamide has a molecular weight of 229.02 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-iodoacetamide is sourced from PubChem (CID 153012942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).