About 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine
6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine (PubChem CID 153013336) has the molecular formula C9H13F3N2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine.
Molecular Properties
| Compound Name | 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine |
| PubChem CID | 153013336 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine |
| SMILES | CC1=C(C)N(N)CCC=C1C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2/c1-6-7(2)14(13)5-3-4-8(6)9(10,11)12/h4H,3,5,13H2,1-2H3 |
| InChIKey | VAMGMCNEIATZMR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine?
The IUPAC name of 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine (CID 153013336) is 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine.
What is the SMILES notation for 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine?
The canonical SMILES for 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine is CC1=C(C)N(N)CCC=C1C(F)(F)F.
What is the InChIKey of 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine?
The InChIKey is VAMGMCNEIATZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2/c1-6-7(2)14(13)5-3-4-8(6)9(10,11)12/h4H,3,5,13H2,1-2H3.
What are the key properties of 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine?
6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine has a molecular weight of 206.21 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-5-(trifluoromethyl)-2,3-dihydroazepin-1-amine is sourced from PubChem (CID 153013336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).