C32H37FN8O2 — CID 153016082
1-[6-(3-fluorooxetan-3-yl)-2-pyridinyl]-6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 153016082) has the molecular formula C32H37FN8O2 and a molecular weight of 584.70 g/mol. Its IUPAC name is 1-[6-(3-fluorooxetan-3-yl)-2-pyridinyl]-6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-(3-fluorooxetan-3-yl)-2-pyridinyl]-6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 153016082 |
| Molecular Formula | C32H37FN8O2 |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 1-[6-(3-fluorooxetan-3-yl)-2-pyridinyl]-6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCC5(CCN(C)CC5)CC4)cc3)nc2n1-c1cccc(C2(F)COC2)n1 |
| InChI | InChI=1S/C32H37FN8O2/c1-3-15-40-29(42)25-20-34-30(37-28(25)41(40)27-6-4-5-26(36-27)32(33)21-43-22-32)35-23-7-9-24(10-8-23)39-18-13-31(14-19-39)11-16-38(2)17-12-31/h3-10,20H,1,11-19,21-22H2,2H3,(H,34,35,37) |
| InChIKey | VAZUDVZOOFPQOB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|