C16H15ClO2 — CID 153023113
7-chloro-5-(2,6-dimethylphenyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 153023113) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 7-chloro-5-(2,6-dimethylphenyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 7-chloro-5-(2,6-dimethylphenyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 153023113 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 7-chloro-5-(2,6-dimethylphenyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1cccc(C)c1-c1cc(Cl)cc2c1OCCO2 |
| InChI | InChI=1S/C16H15ClO2/c1-10-4-3-5-11(2)15(10)13-8-12(17)9-14-16(13)19-7-6-18-14/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | VCHYXDPIGGAQPS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |