About 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate
2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 153027272) has the molecular formula C16H16Cl2O7S2
and a molecular weight of 455.34 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate |
| PubChem CID | 153027272 |
| Molecular Formula | C16H16Cl2O7S2 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | O=C(OCCOCCO)c1ccc(CS(=O)(=O)c2cc(Cl)sc2Cl)cc1O |
| InChI | InChI=1S/C16H16Cl2O7S2/c17-14-8-13(15(18)26-14)27(22,23)9-10-1-2-11(12(20)7-10)16(21)25-6-5-24-4-3-19/h1-2,7-8,19-20H,3-6,9H2 |
| InChIKey | VDCMRYOSZDKURU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate?
The IUPAC name of 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate (CID 153027272) is 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate?
The canonical SMILES for 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate is O=C(OCCOCCO)c1ccc(CS(=O)(=O)c2cc(Cl)sc2Cl)cc1O.
What is the InChIKey of 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate?
The InChIKey is VDCMRYOSZDKURU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2O7S2/c17-14-8-13(15(18)26-14)27(22,23)9-10-1-2-11(12(20)7-10)16(21)25-6-5-24-4-3-19/h1-2,7-8,19-20H,3-6,9H2.
What are the key properties of 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate?
2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate has a molecular weight of 455.34 g/mol, XLogP of 2.90, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethyl 4-[(2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate is sourced from PubChem (CID 153027272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).