C22H24N6OS — CID 153028508
(2S)-2-[[6-[6-[2-(methylamino)ethylamino]-3-pyridinyl]thieno[3,2-d]pyrimidin-4-yl]amino]-2-phenylethanol (PubChem CID 153028508) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is (2S)-2-[[6-[6-[2-(methylamino)ethylamino]-3-pyridinyl]thieno[3,2-d]pyrimidin-4-yl]amino]-2-phenylethanol.
| Compound Name | (2S)-2-[[6-[6-[2-(methylamino)ethylamino]-3-pyridinyl]thieno[3,2-d]pyrimidin-4-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 153028508 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (2S)-2-[[6-[6-[2-(methylamino)ethylamino]-3-pyridinyl]thieno[3,2-d]pyrimidin-4-yl]amino]-2-phenylethanol |
| SMILES | CNCCNc1ccc(-c2cc3ncnc(N[C@H](CO)c4ccccc4)c3s2)cn1 |
| InChI | InChI=1S/C22H24N6OS/c1-23-9-10-24-20-8-7-16(12-25-20)19-11-17-21(30-19)22(27-14-26-17)28-18(13-29)15-5-3-2-4-6-15/h2-8,11-12,14,18,23,29H,9-10,13H2,1H3,(H,24,25)(H,26,27,28)/t18-/m1/s1 |
| InChIKey | VDIPUFMMSJFRQW-GOSISDBHSA-N |
| XLogP | 3.53 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|