About (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine
(E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine (PubChem CID 153034225) has the molecular formula C15H30N4
and a molecular weight of 266.43 g/mol. Its IUPAC name is (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine |
| PubChem CID | 153034225 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine |
| SMILES | CCCN/C=C(\C)C(C)(C)/N=N/C(C)(C)/C(C)=N/C |
| InChI | InChI=1S/C15H30N4/c1-9-10-17-11-12(2)14(4,5)18-19-15(6,7)13(3)16-8/h11,17H,9-10H2,1-8H3/b12-11+,16-13+,19-18+ |
| InChIKey | VEKGXVUJPPSLJI-OMNMBLELSA-N |
| XLogP | 3.99 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine?
The IUPAC name of (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine (CID 153034225) is (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine.
What is the SMILES notation for (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine?
The canonical SMILES for (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine is CCCN/C=C(\C)C(C)(C)/N=N/C(C)(C)/C(C)=N/C.
What is the InChIKey of (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine?
The InChIKey is VEKGXVUJPPSLJI-OMNMBLELSA-N. The full InChI is InChI=1S/C15H30N4/c1-9-10-17-11-12(2)14(4,5)18-19-15(6,7)13(3)16-8/h11,17H,9-10H2,1-8H3/b12-11+,16-13+,19-18+.
What are the key properties of (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine?
(E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine has a molecular weight of 266.43 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-dimethyl-3-[(2-methyl-3-methyliminobutan-2-yl)diazenyl]-N-propylbut-1-en-1-amine is sourced from PubChem (CID 153034225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).