C29H20N2O2 — CID 153035855
3-hydroxy-2-phenyl-7-(4-pyridin-2-ylphenyl)-3H-benzo[de]isoquinolin-1-one (PubChem CID 153035855) has the molecular formula C29H20N2O2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-hydroxy-2-phenyl-7-(4-pyridin-2-ylphenyl)-3H-benzo[de]isoquinolin-1-one.
| Compound Name | 3-hydroxy-2-phenyl-7-(4-pyridin-2-ylphenyl)-3H-benzo[de]isoquinolin-1-one |
|---|---|
| PubChem CID | 153035855 |
| Molecular Formula | C29H20N2O2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-hydroxy-2-phenyl-7-(4-pyridin-2-ylphenyl)-3H-benzo[de]isoquinolin-1-one |
| SMILES | O=C1c2ccc(-c3ccc(-c4ccccn4)cc3)c3cccc(c23)C(O)N1c1ccccc1 |
| InChI | InChI=1S/C29H20N2O2/c32-28-24-10-6-9-23-22(19-12-14-20(15-13-19)26-11-4-5-18-30-26)16-17-25(27(23)24)29(33)31(28)21-7-2-1-3-8-21/h1-18,28,32H |
| InChIKey | VESPDNRHODPXIR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |