C14H17F3N6O5S — CID 153036187
2-[[4-[N-hydroxy-N'-[4-(trifluoromethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl N-ethylsulfamate (PubChem CID 153036187) has the molecular formula C14H17F3N6O5S and a molecular weight of 438.39 g/mol. Its IUPAC name is 2-[[4-[N-hydroxy-N'-[4-(trifluoromethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl N-ethylsulfamate.
| Compound Name | 2-[[4-[N-hydroxy-N'-[4-(trifluoromethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl N-ethylsulfamate |
|---|---|
| PubChem CID | 153036187 |
| Molecular Formula | C14H17F3N6O5S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[[4-[N-hydroxy-N'-[4-(trifluoromethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl N-ethylsulfamate |
| SMILES | CCNS(=O)(=O)OCCNc1nonc1/C(=N/c1ccc(C(F)(F)F)cc1)NO |
| InChI | InChI=1S/C14H17F3N6O5S/c1-2-19-29(25,26)27-8-7-18-12-11(22-28-23-12)13(21-24)20-10-5-3-9(4-6-10)14(15,16)17/h3-6,19,24H,2,7-8H2,1H3,(H,18,23)(H,20,21) |
| InChIKey | VEUCHRAUWUUUEY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|