C24H41BN2O4 — CID 153039371
trans-(1R,2S)-1-amino-2-(pyrrolidin-1-ylmethyl)-5-[2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]cyclohexane-1-carboxylic acid (PubChem CID 153039371) has the molecular formula C24H41BN2O4 and a molecular weight of 432.41 g/mol. Its IUPAC name is trans-(1R,2S)-1-amino-2-(pyrrolidin-1-ylmethyl)-5-[2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2S)-1-amino-2-(pyrrolidin-1-ylmethyl)-5-[2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 153039371 |
| Molecular Formula | C24H41BN2O4 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | trans-(1R,2S)-1-amino-2-(pyrrolidin-1-ylmethyl)-5-[2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(CCC4CC[C@@H](CN5CCCC5)[C@@](N)(C(=O)O)C4)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C24H41BN2O4/c1-22(2)18-12-19(22)23(3)20(13-18)30-25(31-23)9-8-16-6-7-17(15-27-10-4-5-11-27)24(26,14-16)21(28)29/h16-20H,4-15,26H2,1-3H3,(H,28,29)/t16?,17-,18+,19+,20-,23+,24+/m0/s1 |
| InChIKey | VFJKAOXWDTXAOZ-ZHBXCTEISA-N |
| XLogP | 3.40 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|