About 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine
7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine (PubChem CID 153039694) has the molecular formula C10H19F3N2
and a molecular weight of 224.27 g/mol. Its IUPAC name is 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine.
Molecular Properties
| Compound Name | 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine |
| PubChem CID | 153039694 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine |
| SMILES | [H]/N=C(\C)CCCCCCNCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2/c1-9(14)6-4-2-3-5-7-15-8-10(11,12)13/h14-15H,2-8H2,1H3/b14-9+ |
| InChIKey | VFKYDLFLESWMEN-NTEUORMPSA-N |
| XLogP | 3.13 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine?
The IUPAC name of 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine (CID 153039694) is 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine.
What is the SMILES notation for 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine?
The canonical SMILES for 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine is [H]/N=C(\C)CCCCCCNCC(F)(F)F.
What is the InChIKey of 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine?
The InChIKey is VFKYDLFLESWMEN-NTEUORMPSA-N. The full InChI is InChI=1S/C10H19F3N2/c1-9(14)6-4-2-3-5-7-15-8-10(11,12)13/h14-15H,2-8H2,1H3/b14-9+.
What are the key properties of 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine?
7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine has a molecular weight of 224.27 g/mol, XLogP of 3.13, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-imino-N-(2,2,2-trifluoroethyl)octan-1-amine is sourced from PubChem (CID 153039694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).