C14H24N4 — CID 15304008
5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-4,7,11,14-tetraene (PubChem CID 15304008) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-4,7,11,14-tetraene.
| Compound Name | 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-4,7,11,14-tetraene |
|---|---|
| PubChem CID | 15304008 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-4,7,11,14-tetraene |
| SMILES | C/C1=N\CC/N=C(\C)C/C(C)=N/CC/N=C(\C)C1 |
| InChI | InChI=1S/C14H24N4/c1-11-9-12(2)16-7-8-18-14(4)10-13(3)17-6-5-15-11/h5-10H2,1-4H3/b15-11+,16-12+,17-13+,18-14+ |
| InChIKey | VQXSZORDGUCYIM-UKGXNTCXSA-N |
| XLogP | 2.62 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |