C22H21ClFN3O2S — CID 153040366
2-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-1-[5-(4-chlorobut-2-ynoxy)-2-pyridinyl]ethanone (PubChem CID 153040366) has the molecular formula C22H21ClFN3O2S and a molecular weight of 445.95 g/mol. Its IUPAC name is 2-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-1-[5-(4-chlorobut-2-ynoxy)-2-pyridinyl]ethanone.
| Compound Name | 2-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-1-[5-(4-chlorobut-2-ynoxy)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 153040366 |
| Molecular Formula | C22H21ClFN3O2S |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-1-[5-(4-chlorobut-2-ynoxy)-2-pyridinyl]ethanone |
| SMILES | C[C@@]1(c2cc(CC(=O)c3ccc(OCC#CCCl)cn3)ccc2F)CCSC(N)=N1 |
| InChI | InChI=1S/C22H21ClFN3O2S/c1-22(8-11-30-21(25)27-22)17-12-15(4-6-18(17)24)13-20(28)19-7-5-16(14-26-19)29-10-3-2-9-23/h4-7,12,14H,8-11,13H2,1H3,(H2,25,27)/t22-/m0/s1 |
| InChIKey | VFOJAGORVPGLMY-QFIPXVFZSA-N |
| XLogP | 3.93 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|