About 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane
3-ethyl-3-methyl-2-methylidene-1,4-oxathiane (PubChem CID 15304238) has the molecular formula C8H14OS
and a molecular weight of 158.27 g/mol. Its IUPAC name is 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane.
Molecular Properties
| Compound Name | 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane |
| PubChem CID | 15304238 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane |
| SMILES | C=C1OCCSC1(C)CC |
| InChI | InChI=1S/C8H14OS/c1-4-8(3)7(2)9-5-6-10-8/h2,4-6H2,1,3H3 |
| InChIKey | PAUKFBFNCACLCG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane?
The IUPAC name of 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane (CID 15304238) is 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane.
What is the SMILES notation for 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane?
The canonical SMILES for 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane is C=C1OCCSC1(C)CC.
What is the InChIKey of 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane?
The InChIKey is PAUKFBFNCACLCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14OS/c1-4-8(3)7(2)9-5-6-10-8/h2,4-6H2,1,3H3.
What are the key properties of 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane?
3-ethyl-3-methyl-2-methylidene-1,4-oxathiane has a molecular weight of 158.27 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-methyl-2-methylidene-1,4-oxathiane is sourced from PubChem (CID 15304238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).