C24H27NO6 — CID 15304806
butyl 7a-hydroxy-6-methyl-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 15304806) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is butyl 7a-hydroxy-6-methyl-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | butyl 7a-hydroxy-6-methyl-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 15304806 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | butyl 7a-hydroxy-6-methyl-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | CCCCOC(=O)C12CN(C)C(=O)C1(O)OOC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C24H27NO6/c1-3-4-15-29-21(27)22-16-23(18-11-7-5-8-12-18,19-13-9-6-10-14-19)30-31-24(22,28)20(26)25(2)17-22/h5-14,28H,3-4,15-17H2,1-2H3 |
| InChIKey | QIRAQBQRLHWGCV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|