C18H25F2O5PS — CID 15304874
(1S,2S,3R,4R)-2-(benzenesulfonyl)-3-[diethoxyphosphoryl(difluoro)methyl]bicyclo[2.2.1]heptane (PubChem CID 15304874) has the molecular formula C18H25F2O5PS and a molecular weight of 422.43 g/mol. Its IUPAC name is (1S,2S,3R,4R)-2-(benzenesulfonyl)-3-[diethoxyphosphoryl(difluoro)methyl]bicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,3R,4R)-2-(benzenesulfonyl)-3-[diethoxyphosphoryl(difluoro)methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 15304874 |
| Molecular Formula | C18H25F2O5PS |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (1S,2S,3R,4R)-2-(benzenesulfonyl)-3-[diethoxyphosphoryl(difluoro)methyl]bicyclo[2.2.1]heptane |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H25F2O5PS/c1-3-24-26(21,25-4-2)18(19,20)16-13-10-11-14(12-13)17(16)27(22,23)15-8-6-5-7-9-15/h5-9,13-14,16-17H,3-4,10-12H2,1-2H3/t13-,14+,16+,17+/m1/s1 |
| InChIKey | DRVBWTLVGBQWSE-OHFALNGGSA-N |
| XLogP | 4.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|