About 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine
8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (PubChem CID 15304947) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
Analyze 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The IUPAC name of 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (CID 15304947) is 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
What is the SMILES notation for 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The canonical SMILES for 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine is CC1CCCn2nnnc21.
What is the InChIKey of 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
The InChIKey is CCLQZHNZTJRMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-5-3-2-4-10-6(5)7-8-9-10/h5H,2-4H2,1H3.
What are the key properties of 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine?
8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine has a molecular weight of 138.17 g/mol, XLogP of 0.57, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine is sourced from PubChem (CID 15304947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).