About spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane]
spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane] (PubChem CID 15304948) has the molecular formula C7H10N4
and a molecular weight of 150.18 g/mol. Its IUPAC name is spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane].
Molecular Properties
| Compound Name | spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane] |
| PubChem CID | 15304948 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane] |
| SMILES | C1Cn2nnnc2C2(C1)CC2 |
| InChI | InChI=1S/C7H10N4/c1-2-7(3-4-7)6-8-9-10-11(6)5-1/h1-5H2 |
| InChIKey | JWKGETCVSHJUKE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane]?
The IUPAC name of spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane] (CID 15304948) is spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane].
What is the SMILES notation for spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane]?
The canonical SMILES for spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane] is C1Cn2nnnc2C2(C1)CC2.
What is the InChIKey of spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane]?
The InChIKey is JWKGETCVSHJUKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4/c1-2-7(3-4-7)6-8-9-10-11(6)5-1/h1-5H2.
What are the key properties of spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane]?
spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane] has a molecular weight of 150.18 g/mol, XLogP of 0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[6,7-dihydro-5H-tetrazolo[1,5-a]pyridine-8,1'-cyclopropane] is sourced from PubChem (CID 15304948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).