C7H11ClN4 — CID 15304951
8-(2-chloroethyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (PubChem CID 15304951) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is 8-(2-chloroethyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
| Compound Name | 8-(2-chloroethyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 15304951 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 8-(2-chloroethyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine |
| SMILES | ClCCC1CCCn2nnnc21 |
| InChI | InChI=1S/C7H11ClN4/c8-4-3-6-2-1-5-12-7(6)9-10-11-12/h6H,1-5H2 |
| InChIKey | OLGBBFSTAJXPSF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|