About tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate
tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate (PubChem CID 15305847) has the molecular formula C20H33NO3Si
and a molecular weight of 363.57 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate |
| PubChem CID | 15305847 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H33NO3Si/c1-19(2,3)24-18(22)21-16(14-23-25(7,8)20(4,5)6)17(21)15-12-10-9-11-13-15/h9-13,16-17H,14H2,1-8H3/t16-,17+,21?/m1/s1 |
| InChIKey | HLUDKYWSLPTHOV-LXMSXWCSSA-N |
| XLogP | 5.37 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate?
The IUPAC name of tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate (CID 15305847) is tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate is CC(C)(C)OC(=O)N1[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1c1ccccc1.
What is the InChIKey of tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate?
The InChIKey is HLUDKYWSLPTHOV-LXMSXWCSSA-N. The full InChI is InChI=1S/C20H33NO3Si/c1-19(2,3)24-18(22)21-16(14-23-25(7,8)20(4,5)6)17(21)15-12-10-9-11-13-15/h9-13,16-17H,14H2,1-8H3/t16-,17+,21?/m1/s1.
What are the key properties of tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate?
tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate has a molecular weight of 363.57 g/mol, XLogP of 5.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylaziridine-1-carboxylate is sourced from PubChem (CID 15305847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).