C25H17F3N6O3S — CID 153058687
N-[3-[5-(2-aminopyrimidin-4-yl)-1-hydroxy-2-phenylimidazol-4-yl]-2-fluorophenyl]-2,6-difluorobenzenesulfonamide (PubChem CID 153058687) has the molecular formula C25H17F3N6O3S and a molecular weight of 538.51 g/mol. Its IUPAC name is N-[3-[5-(2-aminopyrimidin-4-yl)-1-hydroxy-2-phenylimidazol-4-yl]-2-fluorophenyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[3-[5-(2-aminopyrimidin-4-yl)-1-hydroxy-2-phenylimidazol-4-yl]-2-fluorophenyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 153058687 |
| Molecular Formula | C25H17F3N6O3S |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | N-[3-[5-(2-aminopyrimidin-4-yl)-1-hydroxy-2-phenylimidazol-4-yl]-2-fluorophenyl]-2,6-difluorobenzenesulfonamide |
| SMILES | Nc1nccc(-c2c(-c3cccc(NS(=O)(=O)c4c(F)cccc4F)c3F)nc(-c3ccccc3)n2O)n1 |
| InChI | InChI=1S/C25H17F3N6O3S/c26-16-9-5-10-17(27)23(16)38(36,37)33-18-11-4-8-15(20(18)28)21-22(19-12-13-30-25(29)31-19)34(35)24(32-21)14-6-2-1-3-7-14/h1-13,33,35H,(H2,29,30,31) |
| InChIKey | VJAAGTBVHOPEBR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|