About (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine
(1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine (PubChem CID 153061504) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine.
Molecular Properties
| Compound Name | (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine |
| PubChem CID | 153061504 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine |
| SMILES | CC[C@H]1c2c(ccc3ccccc23)OC[C@@]1(C)N |
| InChI | InChI=1S/C16H19NO/c1-3-13-15-12-7-5-4-6-11(12)8-9-14(15)18-10-16(13,2)17/h4-9,13H,3,10,17H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | VJNPMMDFGRNRMT-XJKSGUPXSA-N |
| XLogP | 3.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine?
The IUPAC name of (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine (CID 153061504) is (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine.
What is the SMILES notation for (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine?
The canonical SMILES for (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine is CC[C@H]1c2c(ccc3ccccc23)OC[C@@]1(C)N.
What is the InChIKey of (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine?
The InChIKey is VJNPMMDFGRNRMT-XJKSGUPXSA-N. The full InChI is InChI=1S/C16H19NO/c1-3-13-15-12-7-5-4-6-11(12)8-9-14(15)18-10-16(13,2)17/h4-9,13H,3,10,17H2,1-2H3/t13-,16+/m0/s1.
What are the key properties of (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine?
(1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine has a molecular weight of 241.33 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-1-ethyl-2-methyl-1,3-dihydrobenzo[f]chromen-2-amine is sourced from PubChem (CID 153061504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).