About 3-hydroxy-1,3-diazinan-4-one
3-hydroxy-1,3-diazinan-4-one (PubChem CID 15306181) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is 3-hydroxy-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-1,3-diazinan-4-one |
| PubChem CID | 15306181 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 3-hydroxy-1,3-diazinan-4-one |
| SMILES | O=C1CCNCN1O |
| InChI | InChI=1S/C4H8N2O2/c7-4-1-2-5-3-6(4)8/h5,8H,1-3H2 |
| InChIKey | BTUSUPRZCRZVIY-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,3-diazinan-4-one?
The IUPAC name of 3-hydroxy-1,3-diazinan-4-one (CID 15306181) is 3-hydroxy-1,3-diazinan-4-one.
What is the SMILES notation for 3-hydroxy-1,3-diazinan-4-one?
The canonical SMILES for 3-hydroxy-1,3-diazinan-4-one is O=C1CCNCN1O.
What is the InChIKey of 3-hydroxy-1,3-diazinan-4-one?
The InChIKey is BTUSUPRZCRZVIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2/c7-4-1-2-5-3-6(4)8/h5,8H,1-3H2.
What are the key properties of 3-hydroxy-1,3-diazinan-4-one?
3-hydroxy-1,3-diazinan-4-one has a molecular weight of 116.12 g/mol, XLogP of -0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,3-diazinan-4-one is sourced from PubChem (CID 15306181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).