About [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate
[(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 15306289) has the molecular formula C17H18F3IO3S
and a molecular weight of 486.29 g/mol. Its IUPAC name is [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| PubChem CID | 15306289 |
| Molecular Formula | C17H18F3IO3S |
| Molecular Weight | 486.29 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(I(OS(=O)(=O)C(F)(F)F)c2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C17H18F3IO3S/c1-11-9-13(3)16(14(4)10-11)21(15-8-6-5-7-12(15)2)24-25(22,23)17(18,19)20/h5-10H,1-4H3 |
| InChIKey | MVCHEOXLERUVDZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The IUPAC name of [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate (CID 15306289) is [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate.
What is the SMILES notation for [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The canonical SMILES for [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate is Cc1cc(C)c(I(OS(=O)(=O)C(F)(F)F)c2ccccc2C)c(C)c1.
What is the InChIKey of [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The InChIKey is MVCHEOXLERUVDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F3IO3S/c1-11-9-13(3)16(14(4)10-11)21(15-8-6-5-7-12(15)2)24-25(22,23)17(18,19)20/h5-10H,1-4H3.
What are the key properties of [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate?
[(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate has a molecular weight of 486.29 g/mol, XLogP of 5.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-methylphenyl)-(2,4,6-trimethylphenyl)-λ3-iodanyl] trifluoromethanesulfonate is sourced from PubChem (CID 15306289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).