About 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one
5,6,8-trimethoxy-1,4-dimethylquinolin-2-one (PubChem CID 15306617) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one.
Molecular Properties
| Compound Name | 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one |
| PubChem CID | 15306617 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one |
| SMILES | COc1cc(OC)c2c(c(C)cc(=O)n2C)c1OC |
| InChI | InChI=1S/C14H17NO4/c1-8-6-11(16)15(2)13-9(17-3)7-10(18-4)14(19-5)12(8)13/h6-7H,1-5H3 |
| InChIKey | PJUNWPXRLZUYPB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one?
The IUPAC name of 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one (CID 15306617) is 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one.
What is the SMILES notation for 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one?
The canonical SMILES for 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one is COc1cc(OC)c2c(c(C)cc(=O)n2C)c1OC.
What is the InChIKey of 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one?
The InChIKey is PJUNWPXRLZUYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-8-6-11(16)15(2)13-9(17-3)7-10(18-4)14(19-5)12(8)13/h6-7H,1-5H3.
What are the key properties of 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one?
5,6,8-trimethoxy-1,4-dimethylquinolin-2-one has a molecular weight of 263.29 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,8-trimethoxy-1,4-dimethylquinolin-2-one is sourced from PubChem (CID 15306617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).