C12H16IN — CID 153067657
3-iodo-5,6,7,8,9,10-hexahydrobenzo[8]annulen-2-amine (PubChem CID 153067657) has the molecular formula C12H16IN and a molecular weight of 301.17 g/mol. Its IUPAC name is 3-iodo-5,6,7,8,9,10-hexahydrobenzo[8]annulen-2-amine.
| Compound Name | 3-iodo-5,6,7,8,9,10-hexahydrobenzo[8]annulen-2-amine |
|---|---|
| PubChem CID | 153067657 |
| Molecular Formula | C12H16IN |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-iodo-5,6,7,8,9,10-hexahydrobenzo[8]annulen-2-amine |
| SMILES | Nc1cc2c(cc1I)CCCCCC2 |
| InChI | InChI=1S/C12H16IN/c13-11-7-9-5-3-1-2-4-6-10(9)8-12(11)14/h7-8H,1-6,14H2 |
| InChIKey | VKSAZWOGHFGVFC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|