About 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one
6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one (PubChem CID 15306798) has the molecular formula C8H8Cl2O3
and a molecular weight of 223.05 g/mol. Its IUPAC name is 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one.
Molecular Properties
| Compound Name | 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one |
| PubChem CID | 15306798 |
| Molecular Formula | C8H8Cl2O3 |
| Molecular Weight | 223.05 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one |
| SMILES | CC1=C(Cl)C(=O)C(Cl)C12OCCO2 |
| InChI | InChI=1S/C8H8Cl2O3/c1-4-5(9)6(11)7(10)8(4)12-2-3-13-8/h7H,2-3H2,1H3 |
| InChIKey | LFXMYGVENKXLQQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.05 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one?
The IUPAC name of 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one (CID 15306798) is 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one.
What is the SMILES notation for 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one?
The canonical SMILES for 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one is CC1=C(Cl)C(=O)C(Cl)C12OCCO2.
What is the InChIKey of 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one?
The InChIKey is LFXMYGVENKXLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O3/c1-4-5(9)6(11)7(10)8(4)12-2-3-13-8/h7H,2-3H2,1H3.
What are the key properties of 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one?
6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one has a molecular weight of 223.05 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-9-methyl-1,4-dioxaspiro[4.4]non-8-en-7-one is sourced from PubChem (CID 15306798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).