C24H21NO6 — CID 15306955
(1'R,2'S,4S)-2'-(furan-2-carbonyl)-1'-(furan-2-yl)-1'-hydroxyspiro[1,3-dihydro-1-benzazepine-4,4'-cyclohexane]-2,5-dione (PubChem CID 15306955) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is (1'R,2'S,4S)-2'-(furan-2-carbonyl)-1'-(furan-2-yl)-1'-hydroxyspiro[1,3-dihydro-1-benzazepine-4,4'-cyclohexane]-2,5-dione.
| Compound Name | (1'R,2'S,4S)-2'-(furan-2-carbonyl)-1'-(furan-2-yl)-1'-hydroxyspiro[1,3-dihydro-1-benzazepine-4,4'-cyclohexane]-2,5-dione |
|---|---|
| PubChem CID | 15306955 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (1'R,2'S,4S)-2'-(furan-2-carbonyl)-1'-(furan-2-yl)-1'-hydroxyspiro[1,3-dihydro-1-benzazepine-4,4'-cyclohexane]-2,5-dione |
| SMILES | O=C1C[C@@]2(CC[C@](O)(c3ccco3)[C@@H](C(=O)c3ccco3)C2)C(=O)c2ccccc2N1 |
| InChI | InChI=1S/C24H21NO6/c26-20-14-23(22(28)15-5-1-2-6-17(15)25-20)9-10-24(29,19-8-4-12-31-19)16(13-23)21(27)18-7-3-11-30-18/h1-8,11-12,16,29H,9-10,13-14H2,(H,25,26)/t16-,23+,24-/m1/s1 |
| InChIKey | QOIBTJCCEGZCMA-QQTNTEGQSA-N |
| XLogP | 3.95 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |