C14H22FNO — CID 153070584
(E)-2-fluoro-5-[[(2E,4Z)-hepta-2,4,6-trienyl]-methylamino]-3-methylpent-2-en-1-ol (PubChem CID 153070584) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is (E)-2-fluoro-5-[[(2E,4Z)-hepta-2,4,6-trienyl]-methylamino]-3-methylpent-2-en-1-ol.
| Compound Name | (E)-2-fluoro-5-[[(2E,4Z)-hepta-2,4,6-trienyl]-methylamino]-3-methylpent-2-en-1-ol |
|---|---|
| PubChem CID | 153070584 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (E)-2-fluoro-5-[[(2E,4Z)-hepta-2,4,6-trienyl]-methylamino]-3-methylpent-2-en-1-ol |
| SMILES | C=C/C=C\C=C\CN(C)CC/C(C)=C(/F)CO |
| InChI | InChI=1S/C14H22FNO/c1-4-5-6-7-8-10-16(3)11-9-13(2)14(15)12-17/h4-8,17H,1,9-12H2,2-3H3/b6-5-,8-7+,14-13+ |
| InChIKey | VLGUFIUTVYSRQT-NBUAZSIDSA-N |
| XLogP | 2.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|