C28H27NO6 — CID 15307096
ethyl 6-benzyl-7a-hydroxy-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 15307096) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is ethyl 6-benzyl-7a-hydroxy-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | ethyl 6-benzyl-7a-hydroxy-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 15307096 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | ethyl 6-benzyl-7a-hydroxy-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | CCOC(=O)C12CN(Cc3ccccc3)C(=O)C1(O)OOC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C28H27NO6/c1-2-33-25(31)26-19-27(22-14-8-4-9-15-22,23-16-10-5-11-17-23)34-35-28(26,32)24(30)29(20-26)18-21-12-6-3-7-13-21/h3-17,32H,2,18-20H2,1H3 |
| InChIKey | AVBLKRZOTVMDJZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|