C27H25NO6 — CID 15307100
methyl 6-benzyl-7a-hydroxy-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 15307100) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is methyl 6-benzyl-7a-hydroxy-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | methyl 6-benzyl-7a-hydroxy-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 15307100 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | methyl 6-benzyl-7a-hydroxy-7-oxo-3,3-diphenyl-4,5-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | COC(=O)C12CN(Cc3ccccc3)C(=O)C1(O)OOC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C27H25NO6/c1-32-24(30)25-18-26(21-13-7-3-8-14-21,22-15-9-4-10-16-22)33-34-27(25,31)23(29)28(19-25)17-20-11-5-2-6-12-20/h2-16,31H,17-19H2,1H3 |
| InChIKey | WBONQUBVWQVEOO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|