C25H27NO5 — CID 15307164
(2R,3R,4S,7R,8S,9S,11R,12R,13S,16R,17S,18S)-20-(2-methoxyethyl)-22,24-dioxa-20-azanonacyclo[8.8.3.12,9.14,7.111,18.113,16.01,10.03,8.012,17]pentacosa-5,14-diene-19,21-dione (PubChem CID 15307164) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (2R,3R,4S,7R,8S,9S,11R,12R,13S,16R,17S,18S)-20-(2-methoxyethyl)-22,24-dioxa-20-azanonacyclo[8.8.3.12,9.14,7.111,18.113,16.01,10.03,8.012,17]pentacosa-5,14-diene-19,21-dione.
| Compound Name | (2R,3R,4S,7R,8S,9S,11R,12R,13S,16R,17S,18S)-20-(2-methoxyethyl)-22,24-dioxa-20-azanonacyclo[8.8.3.12,9.14,7.111,18.113,16.01,10.03,8.012,17]pentacosa-5,14-diene-19,21-dione |
|---|---|
| PubChem CID | 15307164 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (2R,3R,4S,7R,8S,9S,11R,12R,13S,16R,17S,18S)-20-(2-methoxyethyl)-22,24-dioxa-20-azanonacyclo[8.8.3.12,9.14,7.111,18.113,16.01,10.03,8.012,17]pentacosa-5,14-diene-19,21-dione |
| SMILES | COCCN1C(=O)C23[C@@H]4O[C@@H]([C@@H]5[C@H]4[C@@H]4C=C[C@H]5C4)C2(C1=O)[C@@H]1O[C@H]3[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C25H27NO5/c1-29-7-6-26-22(27)24-18-14-10-2-3-11(8-10)15(14)19(30-18)25(24,23(26)28)21-17-13-5-4-12(9-13)16(17)20(24)31-21/h2-5,10-21H,6-9H2,1H3/t10-,11+,12+,13-,14-,15+,16+,17-,18-,19+,20+,21-,24?,25? |
| InChIKey | VAOWWUFVPMLFSZ-CMBRJNPESA-N |
| XLogP | 1.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|