About (E)-pent-3-enethioamide
(E)-pent-3-enethioamide (PubChem CID 15307430) has the molecular formula C5H9NS
and a molecular weight of 115.20 g/mol. Its IUPAC name is (E)-pent-3-enethioamide.
Molecular Properties
| Compound Name | (E)-pent-3-enethioamide |
| PubChem CID | 15307430 |
| Molecular Formula | C5H9NS |
| Molecular Weight | 115.20 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | (E)-pent-3-enethioamide |
| SMILES | C/C=C/CC(N)=S |
| InChI | InChI=1S/C5H9NS/c1-2-3-4-5(6)7/h2-3H,4H2,1H3,(H2,6,7)/b3-2+ |
| InChIKey | VHGJTBXIGLAUSJ-NSCUHMNNSA-N |
| XLogP | 1.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-pent-3-enethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-pent-3-enethioamide?
The IUPAC name of (E)-pent-3-enethioamide (CID 15307430) is (E)-pent-3-enethioamide.
What is the SMILES notation for (E)-pent-3-enethioamide?
The canonical SMILES for (E)-pent-3-enethioamide is C/C=C/CC(N)=S.
What is the InChIKey of (E)-pent-3-enethioamide?
The InChIKey is VHGJTBXIGLAUSJ-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H9NS/c1-2-3-4-5(6)7/h2-3H,4H2,1H3,(H2,6,7)/b3-2+.
What are the key properties of (E)-pent-3-enethioamide?
(E)-pent-3-enethioamide has a molecular weight of 115.20 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-pent-3-enethioamide is sourced from PubChem (CID 15307430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).