About ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate
ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate (PubChem CID 15307455) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate |
| PubChem CID | 15307455 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate |
| SMILES | CCOC(=O)/C=C1/CCC(C)(C)C1 |
| InChI | InChI=1S/C11H18O2/c1-4-13-10(12)7-9-5-6-11(2,3)8-9/h7H,4-6,8H2,1-3H3/b9-7- |
| InChIKey | BVJWGZJNMXJKFM-CLFYSBASSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate?
The IUPAC name of ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate (CID 15307455) is ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate.
What is the SMILES notation for ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate?
The canonical SMILES for ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate is CCOC(=O)/C=C1/CCC(C)(C)C1.
What is the InChIKey of ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate?
The InChIKey is BVJWGZJNMXJKFM-CLFYSBASSA-N. The full InChI is InChI=1S/C11H18O2/c1-4-13-10(12)7-9-5-6-11(2,3)8-9/h7H,4-6,8H2,1-3H3/b9-7-.
What are the key properties of ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate?
ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate has a molecular weight of 182.26 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-(3,3-dimethylcyclopentylidene)acetate is sourced from PubChem (CID 15307455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).