About 2,5-diphenyl-1,3-oxazole-4-carboxylic acid
2,5-diphenyl-1,3-oxazole-4-carboxylic acid (PubChem CID 15307665) has the molecular formula C16H11NO3
and a molecular weight of 265.27 g/mol. Its IUPAC name is 2,5-diphenyl-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2,5-diphenyl-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 15307665 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2,5-diphenyl-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C16H11NO3/c18-16(19)13-14(11-7-3-1-4-8-11)20-15(17-13)12-9-5-2-6-10-12/h1-10H,(H,18,19) |
| InChIKey | YKZSHSBBYKLXNM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-diphenyl-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diphenyl-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2,5-diphenyl-1,3-oxazole-4-carboxylic acid (CID 15307665) is 2,5-diphenyl-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2,5-diphenyl-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2,5-diphenyl-1,3-oxazole-4-carboxylic acid is O=C(O)c1nc(-c2ccccc2)oc1-c1ccccc1.
What is the InChIKey of 2,5-diphenyl-1,3-oxazole-4-carboxylic acid?
The InChIKey is YKZSHSBBYKLXNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO3/c18-16(19)13-14(11-7-3-1-4-8-11)20-15(17-13)12-9-5-2-6-10-12/h1-10H,(H,18,19).
What are the key properties of 2,5-diphenyl-1,3-oxazole-4-carboxylic acid?
2,5-diphenyl-1,3-oxazole-4-carboxylic acid has a molecular weight of 265.27 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diphenyl-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 15307665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).