C28H62O7Si4 — CID 153085177
[(2R,4S,5R)-2-[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane (PubChem CID 153085177) has the molecular formula C28H62O7Si4 and a molecular weight of 623.14 g/mol. Its IUPAC name is [(2R,4S,5R)-2-[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane.
| Compound Name | [(2R,4S,5R)-2-[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 153085177 |
| Molecular Formula | C28H62O7Si4 |
| Molecular Weight | 623.14 g/mol |
| Exact Mass | 622.36 |
| IUPAC Name | [(2R,4S,5R)-2-[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane |
| SMILES | CCC1O[C@H](O[C@H]2OC(CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C28H62O7Si4/c1-17-22-20(3)19(2)21(4)27(30-22)32-28-26(35-39(14,15)16)25(34-38(11,12)13)24(33-37(8,9)10)23(31-28)18-29-36(5,6)7/h19-28H,17-18H2,1-16H3/t19-,20-,21?,22?,23?,24+,25-,26?,27+,28+/m0/s1 |
| InChIKey | VOBKUTWENHPFFF-ZEKXJSDHSA-N |
| XLogP | 7.28 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.14 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|