C42H43N5 — CID 153088892
10-[3-(3,4,6a,7,8,10a-hexahydro-1,10-phenanthrolin-5-yl)-1,2-dihydropyridin-6-yl]-7-(1,8a-dihydroquinolin-2-yl)-1,2,3,4,6a,7a,11a,11b-octahydrobenzo[c]carbazole (PubChem CID 153088892) has the molecular formula C42H43N5 and a molecular weight of 617.84 g/mol. Its IUPAC name is 10-[3-(3,4,6a,7,8,10a-hexahydro-1,10-phenanthrolin-5-yl)-1,2-dihydropyridin-6-yl]-7-(1,8a-dihydroquinolin-2-yl)-1,2,3,4,6a,7a,11a,11b-octahydrobenzo[c]carbazole.
| Compound Name | 10-[3-(3,4,6a,7,8,10a-hexahydro-1,10-phenanthrolin-5-yl)-1,2-dihydropyridin-6-yl]-7-(1,8a-dihydroquinolin-2-yl)-1,2,3,4,6a,7a,11a,11b-octahydrobenzo[c]carbazole |
|---|---|
| PubChem CID | 153088892 |
| Molecular Formula | C42H43N5 |
| Molecular Weight | 617.84 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | 10-[3-(3,4,6a,7,8,10a-hexahydro-1,10-phenanthrolin-5-yl)-1,2-dihydropyridin-6-yl]-7-(1,8a-dihydroquinolin-2-yl)-1,2,3,4,6a,7a,11a,11b-octahydrobenzo[c]carbazole |
| SMILES | C1=CC2=CC=C(N3C4C=CC(C5=CC=C(C6=CC7CCC=NC7C7=C6CCC=N7)CN5)=CC4C4C5=C(C=CC43)CCCC5)NC2C=C1 |
| InChI | InChI=1S/C42H43N5/c1-3-10-31-26(7-1)14-19-38-40(31)34-23-28(15-18-37(34)47(38)39-20-16-27-8-2-4-12-36(27)46-39)35-17-13-30(25-45-35)33-24-29-9-5-21-43-41(29)42-32(33)11-6-22-44-42/h2,4,8,12-24,29,34,36-38,40-41,45-46H,1,3,5-7,9-11,25H2 |
| InChIKey | VOTGGDMTSAHJAK-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.84 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |