About 5a,9a,10,10a-tetrahydro-4aH-phenoxazine
5a,9a,10,10a-tetrahydro-4aH-phenoxazine (PubChem CID 153089951) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5a,9a,10,10a-tetrahydro-4aH-phenoxazine.
Molecular Properties
| Compound Name | 5a,9a,10,10a-tetrahydro-4aH-phenoxazine |
| PubChem CID | 153089951 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5a,9a,10,10a-tetrahydro-4aH-phenoxazine |
| SMILES | C1=CC2NC3C=CC=CC3OC2C=C1 |
| InChI | InChI=1S/C12H13NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-13H |
| InChIKey | VOYSKYHKCYRPMJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5a,9a,10,10a-tetrahydro-4aH-phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5a,9a,10,10a-tetrahydro-4aH-phenoxazine?
The IUPAC name of 5a,9a,10,10a-tetrahydro-4aH-phenoxazine (CID 153089951) is 5a,9a,10,10a-tetrahydro-4aH-phenoxazine.
What is the SMILES notation for 5a,9a,10,10a-tetrahydro-4aH-phenoxazine?
The canonical SMILES for 5a,9a,10,10a-tetrahydro-4aH-phenoxazine is C1=CC2NC3C=CC=CC3OC2C=C1.
What is the InChIKey of 5a,9a,10,10a-tetrahydro-4aH-phenoxazine?
The InChIKey is VOYSKYHKCYRPMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-13H.
What are the key properties of 5a,9a,10,10a-tetrahydro-4aH-phenoxazine?
5a,9a,10,10a-tetrahydro-4aH-phenoxazine has a molecular weight of 187.24 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5a,9a,10,10a-tetrahydro-4aH-phenoxazine is sourced from PubChem (CID 153089951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).