C19H26O8 — CID 15309121
tetraethyl bicyclo[2.2.1]hept-5-ene-2,2,3,3-tetracarboxylate (PubChem CID 15309121) has the molecular formula C19H26O8 and a molecular weight of 382.41 g/mol. Its IUPAC name is tetraethyl bicyclo[2.2.1]hept-5-ene-2,2,3,3-tetracarboxylate.
| Compound Name | tetraethyl bicyclo[2.2.1]hept-5-ene-2,2,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 15309121 |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | tetraethyl bicyclo[2.2.1]hept-5-ene-2,2,3,3-tetracarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C2C=CC(C2)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H26O8/c1-5-24-14(20)18(15(21)25-6-2)12-9-10-13(11-12)19(18,16(22)26-7-3)17(23)27-8-4/h9-10,12-13H,5-8,11H2,1-4H3 |
| InChIKey | BMHJCTBMXDYWBL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|