C7H11N2+ — CID 153091342
3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-7-ium (PubChem CID 153091342) has the molecular formula C7H11N2+ and a molecular weight of 123.18 g/mol. Its IUPAC name is 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-7-ium.
| Compound Name | 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-7-ium |
|---|---|
| PubChem CID | 153091342 |
| Molecular Formula | C7H11N2+ |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | 3-methyl-3a,4,5,6-tetrahydropyrrolo[1,2-b]pyrazol-7-ium |
| SMILES | CC1=CN=[N+]2CCCC12 |
| InChI | InChI=1S/C7H11N2/c1-6-5-8-9-4-2-3-7(6)9/h5,7H,2-4H2,1H3/q+1 |
| InChIKey | GIBZUGQNWHALLF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|