C12H24O — CID 153093086
(3S,4R,6R)-3,4,6-trimethyl-2-(2-methylpropyl)oxane (PubChem CID 153093086) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (3S,4R,6R)-3,4,6-trimethyl-2-(2-methylpropyl)oxane.
| Compound Name | (3S,4R,6R)-3,4,6-trimethyl-2-(2-methylpropyl)oxane |
|---|---|
| PubChem CID | 153093086 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (3S,4R,6R)-3,4,6-trimethyl-2-(2-methylpropyl)oxane |
| SMILES | CC(C)CC1O[C@H](C)C[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C12H24O/c1-8(2)6-12-11(5)9(3)7-10(4)13-12/h8-12H,6-7H2,1-5H3/t9-,10-,11+,12?/m1/s1 |
| InChIKey | IRBIXRCHTWQTGX-YIBTVLSRSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |