C21H38N6O2 — CID 15309366
1,3,5-tris(piperidin-1-ylmethyl)-1,3,5-triazinane-2,4-dione (PubChem CID 15309366) has the molecular formula C21H38N6O2 and a molecular weight of 406.58 g/mol. Its IUPAC name is 1,3,5-tris(piperidin-1-ylmethyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3,5-tris(piperidin-1-ylmethyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 15309366 |
| Molecular Formula | C21H38N6O2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 1,3,5-tris(piperidin-1-ylmethyl)-1,3,5-triazinane-2,4-dione |
| SMILES | O=C1N(CN2CCCCC2)CN(CN2CCCCC2)C(=O)N1CN1CCCCC1 |
| InChI | InChI=1S/C21H38N6O2/c28-20-25(16-22-10-4-1-5-11-22)19-26(17-23-12-6-2-7-13-23)21(29)27(20)18-24-14-8-3-9-15-24/h1-19H2 |
| InChIKey | URGPRDDAJHOCTL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |