C5H9N3O4 — CID 15309371
1,5-bis(hydroxymethyl)-1,3,5-triazinane-2,4-dione (PubChem CID 15309371) has the molecular formula C5H9N3O4 and a molecular weight of 175.14 g/mol. Its IUPAC name is 1,5-bis(hydroxymethyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,5-bis(hydroxymethyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 15309371 |
| Molecular Formula | C5H9N3O4 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1,5-bis(hydroxymethyl)-1,3,5-triazinane-2,4-dione |
| SMILES | O=C1NC(=O)N(CO)CN1CO |
| InChI | InChI=1S/C5H9N3O4/c9-2-7-1-8(3-10)5(12)6-4(7)11/h9-10H,1-3H2,(H,6,11,12) |
| InChIKey | QHOMGWGICGVBIY-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |