C29H33Cl2N7O3 — CID 153094493
1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(ethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 153094493) has the molecular formula C29H33Cl2N7O3 and a molecular weight of 598.54 g/mol. Its IUPAC name is 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(ethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(ethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 153094493 |
| Molecular Formula | C29H33Cl2N7O3 |
| Molecular Weight | 598.54 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(ethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(CCCc2cn3c(n2)c(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(NCC)nc23)CC1 |
| InChI | InChI=1S/C29H33Cl2N7O3/c1-5-23(39)37-12-10-36(11-13-37)9-7-8-19-17-38-27-18(16-33-29(35-27)32-6-2)14-20(28(38)34-19)24-25(30)21(40-3)15-22(41-4)26(24)31/h5,14-17H,1,6-13H2,2-4H3,(H,32,33,35) |
| InChIKey | VPVHSKPAISNXDR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|