C20H23NO7 — CID 15309458
8a-O-benzyl 2-O-methyl (4aR,8S,8aS)-8-methoxy-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-2,8a-dicarboxylate (PubChem CID 15309458) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is 8a-O-benzyl 2-O-methyl (4aR,8S,8aS)-8-methoxy-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-2,8a-dicarboxylate.
| Compound Name | 8a-O-benzyl 2-O-methyl (4aR,8S,8aS)-8-methoxy-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-2,8a-dicarboxylate |
|---|---|
| PubChem CID | 15309458 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 8a-O-benzyl 2-O-methyl (4aR,8S,8aS)-8-methoxy-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-2,8a-dicarboxylate |
| SMILES | COC(=O)N1CC[C@@H]2CC(=O)C[C@H](OC)[C@]2(C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H23NO7/c1-26-16-11-15(22)10-14-8-9-21(19(25)27-2)17(23)20(14,16)18(24)28-12-13-6-4-3-5-7-13/h3-7,14,16H,8-12H2,1-2H3/t14-,16+,20+/m1/s1 |
| InChIKey | KBPZEZVLCFVYGZ-IIMJZQEZSA-N |
| XLogP | 1.71 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|