About 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate
2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate (PubChem CID 153095472) has the molecular formula C22H22ClN3O3
and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate.
Molecular Properties
| Compound Name | 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate |
| PubChem CID | 153095472 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate |
| SMILES | CN(CCOC(=O)Nc1cnc2ccccc2c1)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C22H22ClN3O3/c1-26(21(27)11-10-16-6-2-4-8-19(16)23)12-13-29-22(28)25-18-14-17-7-3-5-9-20(17)24-15-18/h2-9,14-15H,10-13H2,1H3,(H,25,28) |
| InChIKey | VQACBLYSQKWILS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate?
The IUPAC name of 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate (CID 153095472) is 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate.
What is the SMILES notation for 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate?
The canonical SMILES for 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate is CN(CCOC(=O)Nc1cnc2ccccc2c1)C(=O)CCc1ccccc1Cl.
What is the InChIKey of 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate?
The InChIKey is VQACBLYSQKWILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClN3O3/c1-26(21(27)11-10-16-6-2-4-8-19(16)23)12-13-29-22(28)25-18-14-17-7-3-5-9-20(17)24-15-18/h2-9,14-15H,10-13H2,1H3,(H,25,28).
What are the key properties of 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate?
2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate has a molecular weight of 411.89 g/mol, XLogP of 4.53, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-quinolin-3-ylcarbamate is sourced from PubChem (CID 153095472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).