C32H27N5OS — CID 15309716
5-(4-methylphenyl)-12,13-diphenyl-4-piperidin-1-yl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 15309716) has the molecular formula C32H27N5OS and a molecular weight of 529.67 g/mol. Its IUPAC name is 5-(4-methylphenyl)-12,13-diphenyl-4-piperidin-1-yl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 5-(4-methylphenyl)-12,13-diphenyl-4-piperidin-1-yl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 15309716 |
| Molecular Formula | C32H27N5OS |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 5-(4-methylphenyl)-12,13-diphenyl-4-piperidin-1-yl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | Cc1ccc(-n2c(N3CCCCC3)nc3c(sc4nnc(-c5ccccc5)c(-c5ccccc5)c43)c2=O)cc1 |
| InChI | InChI=1S/C32H27N5OS/c1-21-15-17-24(18-16-21)37-31(38)29-28(33-32(37)36-19-9-4-10-20-36)26-25(22-11-5-2-6-12-22)27(34-35-30(26)39-29)23-13-7-3-8-14-23/h2-3,5-8,11-18H,4,9-10,19-20H2,1H3 |
| InChIKey | GVMGTAZHDJDMSI-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |