C17H19BFNO9 — CID 153097752
[2-(dimethylamino)-2-oxoethoxy]methoxycarbonyloxymethyl (1aR,7bS)-5-fluoro-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylate (PubChem CID 153097752) has the molecular formula C17H19BFNO9 and a molecular weight of 411.15 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethoxy]methoxycarbonyloxymethyl (1aR,7bS)-5-fluoro-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylate.
| Compound Name | [2-(dimethylamino)-2-oxoethoxy]methoxycarbonyloxymethyl (1aR,7bS)-5-fluoro-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylate |
|---|---|
| PubChem CID | 153097752 |
| Molecular Formula | C17H19BFNO9 |
| Molecular Weight | 411.15 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethoxy]methoxycarbonyloxymethyl (1aR,7bS)-5-fluoro-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylate |
| SMILES | CN(C)C(=O)COCOC(=O)OCOC(=O)c1c(F)ccc2c1OB(O)[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C17H19BFNO9/c1-20(2)13(21)6-25-7-27-17(23)28-8-26-16(22)14-12(19)4-3-9-10-5-11(10)18(24)29-15(9)14/h3-4,10-11,24H,5-8H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | VQLPPEABSMEZAN-GHMZBOCLSA-N |
| XLogP | 0.89 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|