C20H36O4Si — CID 15309935
(3S,3aR,9aS)-3-[tert-butyl(dimethyl)silyl]oxy-9a-methylspiro[1,2,3,3a,4,6,7,8-octahydrocyclopenta[8]annulene-9,2'-1,3-dioxolane]-5-one (PubChem CID 15309935) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (3S,3aR,9aS)-3-[tert-butyl(dimethyl)silyl]oxy-9a-methylspiro[1,2,3,3a,4,6,7,8-octahydrocyclopenta[8]annulene-9,2'-1,3-dioxolane]-5-one.
| Compound Name | (3S,3aR,9aS)-3-[tert-butyl(dimethyl)silyl]oxy-9a-methylspiro[1,2,3,3a,4,6,7,8-octahydrocyclopenta[8]annulene-9,2'-1,3-dioxolane]-5-one |
|---|---|
| PubChem CID | 15309935 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (3S,3aR,9aS)-3-[tert-butyl(dimethyl)silyl]oxy-9a-methylspiro[1,2,3,3a,4,6,7,8-octahydrocyclopenta[8]annulene-9,2'-1,3-dioxolane]-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)[C@H]1CC(=O)CCCC21OCCO1 |
| InChI | InChI=1S/C20H36O4Si/c1-18(2,3)25(5,6)24-17-9-11-19(4)16(17)14-15(21)8-7-10-20(19)22-12-13-23-20/h16-17H,7-14H2,1-6H3/t16-,17-,19-/m0/s1 |
| InChIKey | DIFCYYVYZWJDEX-LNLFQRSKSA-N |
| XLogP | 4.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|