About 4-acetyloxolan-3-one
4-acetyloxolan-3-one (PubChem CID 15310430) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 4-acetyloxolan-3-one.
Molecular Properties
| Compound Name | 4-acetyloxolan-3-one |
| PubChem CID | 15310430 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 4-acetyloxolan-3-one |
| SMILES | CC(=O)C1COCC1=O |
| InChI | InChI=1S/C6H8O3/c1-4(7)5-2-9-3-6(5)8/h5H,2-3H2,1H3 |
| InChIKey | GWFYHSOSBXBTES-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyloxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyloxolan-3-one?
The IUPAC name of 4-acetyloxolan-3-one (CID 15310430) is 4-acetyloxolan-3-one.
What is the SMILES notation for 4-acetyloxolan-3-one?
The canonical SMILES for 4-acetyloxolan-3-one is CC(=O)C1COCC1=O.
What is the InChIKey of 4-acetyloxolan-3-one?
The InChIKey is GWFYHSOSBXBTES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-4(7)5-2-9-3-6(5)8/h5H,2-3H2,1H3.
What are the key properties of 4-acetyloxolan-3-one?
4-acetyloxolan-3-one has a molecular weight of 128.13 g/mol, XLogP of -0.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyloxolan-3-one is sourced from PubChem (CID 15310430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).